About 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole
3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole (PubChem CID 145444309) has the molecular formula C12H5Cl2F2N3
and a molecular weight of 300.10 g/mol. Its IUPAC name is 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole.
Molecular Properties
| Compound Name | 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole |
| PubChem CID | 145444309 |
| Molecular Formula | C12H5Cl2F2N3 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole |
| SMILES | Fc1cc2[nH]cc(-c3nc(Cl)ncc3Cl)c2cc1F |
| InChI | InChI=1S/C12H5Cl2F2N3/c13-7-4-18-12(14)19-11(7)6-3-17-10-2-9(16)8(15)1-5(6)10/h1-4,17H |
| InChIKey | WRRSOTOUPVLIGY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole?
The IUPAC name of 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole (CID 145444309) is 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole.
What is the SMILES notation for 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole?
The canonical SMILES for 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole is Fc1cc2[nH]cc(-c3nc(Cl)ncc3Cl)c2cc1F.
What is the InChIKey of 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole?
The InChIKey is WRRSOTOUPVLIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Cl2F2N3/c13-7-4-18-12(14)19-11(7)6-3-17-10-2-9(16)8(15)1-5(6)10/h1-4,17H.
What are the key properties of 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole?
3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole has a molecular weight of 300.10 g/mol, XLogP of 4.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dichloropyrimidin-4-yl)-5,6-difluoro-1H-indole is sourced from PubChem (CID 145444309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).