C55H46N2OS — CID 145444880
2-(4-carbazol-9-ylphenyl)-6-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]thioxanthen-9-one;ethane;prop-1-ene (PubChem CID 145444880) has the molecular formula C55H46N2OS and a molecular weight of 783.05 g/mol. Its IUPAC name is 2-(4-carbazol-9-ylphenyl)-6-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]thioxanthen-9-one;ethane;prop-1-ene.
| Compound Name | 2-(4-carbazol-9-ylphenyl)-6-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]thioxanthen-9-one;ethane;prop-1-ene |
|---|---|
| PubChem CID | 145444880 |
| Molecular Formula | C55H46N2OS |
| Molecular Weight | 783.05 g/mol |
| Exact Mass | 782.33 |
| IUPAC Name | 2-(4-carbazol-9-ylphenyl)-6-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]thioxanthen-9-one;ethane;prop-1-ene |
| SMILES | C=CC.C=Cc1c(/C=C\C)n(-c2ccc(-c3ccc4c(=O)c5cc(-c6ccc(-n7c8ccccc8c8ccccc87)cc6)ccc5sc4c3)cc2)c2ccccc12.CC |
| InChI | InChI=1S/C50H34N2OS.C3H6.C2H6/c1-3-11-44-38(4-2)39-12-5-8-15-45(39)51(44)36-26-20-33(21-27-36)35-22-28-42-49(31-35)54-48-29-23-34(30-43(48)50(42)53)32-18-24-37(25-19-32)52-46-16-9-6-13-40(46)41-14-7-10-17-47(41)52;1-3-2;1-2/h3-31H,2H2,1H3;3H,1H2,2H3;1-2H3/b11-3-;; |
| InChIKey | LXSXWTDSJLWFQY-APRVNQMFSA-N |
| XLogP | 15.68 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.05 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|