About (Z)-but-2-enimidamide;ethane
(Z)-but-2-enimidamide;ethane (PubChem CID 145445334) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is (Z)-but-2-enimidamide;ethane.
Molecular Properties
| Compound Name | (Z)-but-2-enimidamide;ethane |
| PubChem CID | 145445334 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (Z)-but-2-enimidamide;ethane |
| SMILES | CC.[H]/N=C(N)/C=C\C |
| InChI | InChI=1S/C4H8N2.C2H6/c1-2-3-4(5)6;1-2/h2-3H,1H3,(H3,5,6);1-2H3/b3-2-; |
| InChIKey | BKOADDSZXLZCHZ-OLGQORCHSA-N |
| XLogP | 1.52 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enimidamide;ethane?
The IUPAC name of (Z)-but-2-enimidamide;ethane (CID 145445334) is (Z)-but-2-enimidamide;ethane.
What is the SMILES notation for (Z)-but-2-enimidamide;ethane?
The canonical SMILES for (Z)-but-2-enimidamide;ethane is CC.[H]/N=C(N)/C=C\C.
What is the InChIKey of (Z)-but-2-enimidamide;ethane?
The InChIKey is BKOADDSZXLZCHZ-OLGQORCHSA-N. The full InChI is InChI=1S/C4H8N2.C2H6/c1-2-3-4(5)6;1-2/h2-3H,1H3,(H3,5,6);1-2H3/b3-2-;.
What are the key properties of (Z)-but-2-enimidamide;ethane?
(Z)-but-2-enimidamide;ethane has a molecular weight of 114.19 g/mol, XLogP of 1.52, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enimidamide;ethane is sourced from PubChem (CID 145445334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).