C28H44 — CID 14544609
(5E,9E,13E,17E)-5,9,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-1-yne (PubChem CID 14544609) has the molecular formula C28H44 and a molecular weight of 380.66 g/mol. Its IUPAC name is (5E,9E,13E,17E)-5,9,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-1-yne.
| Compound Name | (5E,9E,13E,17E)-5,9,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-1-yne |
|---|---|
| PubChem CID | 14544609 |
| Molecular Formula | C28H44 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | (5E,9E,13E,17E)-5,9,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-1-yne |
| SMILES | C#CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C28H44/c1-8-9-16-25(4)20-13-21-26(5)17-10-11-18-27(6)22-14-23-28(7)19-12-15-24(2)3/h1,15,17-18,20,23H,9-14,16,19,21-22H2,2-7H3/b25-20+,26-17+,27-18+,28-23+ |
| InChIKey | KXVKTTDHPAHWSP-ONQTWPEOSA-N |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|