C26H38 — CID 14544610
(5E,9E,13E,17E)-5,9,14,18-tetramethyldocosa-5,9,13,17-tetraen-1,21-diyne (PubChem CID 14544610) has the molecular formula C26H38 and a molecular weight of 350.59 g/mol. Its IUPAC name is (5E,9E,13E,17E)-5,9,14,18-tetramethyldocosa-5,9,13,17-tetraen-1,21-diyne.
| Compound Name | (5E,9E,13E,17E)-5,9,14,18-tetramethyldocosa-5,9,13,17-tetraen-1,21-diyne |
|---|---|
| PubChem CID | 14544610 |
| Molecular Formula | C26H38 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | (5E,9E,13E,17E)-5,9,14,18-tetramethyldocosa-5,9,13,17-tetraen-1,21-diyne |
| SMILES | C#CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC#C |
| InChI | InChI=1S/C26H38/c1-7-9-15-23(3)19-13-21-25(5)17-11-12-18-26(6)22-14-20-24(4)16-10-8-2/h1-2,17-20H,9-16,21-22H2,3-6H3/b23-19+,24-20+,25-17+,26-18+ |
| InChIKey | ZFMFZTOEMOMUMG-LQEDCYEGSA-N |
| XLogP | 7.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|