C28H42O2 — CID 14544612
(6E,10E,14E,18E)-6,10,15,19-tetramethyltetracosa-6,10,14,18-tetraen-1,23-diyne-3,22-diol (PubChem CID 14544612) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is (6E,10E,14E,18E)-6,10,15,19-tetramethyltetracosa-6,10,14,18-tetraen-1,23-diyne-3,22-diol.
| Compound Name | (6E,10E,14E,18E)-6,10,15,19-tetramethyltetracosa-6,10,14,18-tetraen-1,23-diyne-3,22-diol |
|---|---|
| PubChem CID | 14544612 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | (6E,10E,14E,18E)-6,10,15,19-tetramethyltetracosa-6,10,14,18-tetraen-1,23-diyne-3,22-diol |
| SMILES | C#CC(O)CC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC(O)C#C |
| InChI | InChI=1S/C28H42O2/c1-7-27(29)21-19-25(5)17-11-15-23(3)13-9-10-14-24(4)16-12-18-26(6)20-22-28(30)8-2/h1-2,13-14,17-18,27-30H,9-12,15-16,19-22H2,3-6H3/b23-13+,24-14+,25-17+,26-18+ |
| InChIKey | KLCLKOLLZKAMSI-TXLDAEQNSA-N |
| XLogP | 6.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|