C29H46 — CID 14544614
(6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-1,2,6,10,14,18,22-heptaene (PubChem CID 14544614) has the molecular formula C29H46 and a molecular weight of 394.69 g/mol. Its IUPAC name is (6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-1,2,6,10,14,18,22-heptaene.
| Compound Name | (6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-1,2,6,10,14,18,22-heptaene |
|---|---|
| PubChem CID | 14544614 |
| Molecular Formula | C29H46 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | (6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-1,2,6,10,14,18,22-heptaene |
| SMILES | C=C=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C29H46/c1-8-9-10-17-26(4)21-14-22-27(5)18-11-12-19-28(6)23-15-24-29(7)20-13-16-25(2)3/h9,16,18-19,21,24H,1,10-15,17,20,22-23H2,2-7H3/b26-21+,27-18+,28-19+,29-24+ |
| InChIKey | JPXBVBHEFLSWTH-LPOFEHKLSA-N |
| XLogP | 9.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|