C32H52 — CID 14544622
[(2E,6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaen-2-yl]cyclopropane (PubChem CID 14544622) has the molecular formula C32H52 and a molecular weight of 436.77 g/mol. Its IUPAC name is [(2E,6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaen-2-yl]cyclopropane.
| Compound Name | [(2E,6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaen-2-yl]cyclopropane |
|---|---|
| PubChem CID | 14544622 |
| Molecular Formula | C32H52 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.41 |
| IUPAC Name | [(2E,6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaen-2-yl]cyclopropane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)C1CC1 |
| InChI | InChI=1S/C32H52/c1-26(2)14-10-17-29(5)20-11-18-27(3)15-8-9-16-28(4)19-12-21-30(6)22-13-23-31(7)32-24-25-32/h14-16,20-21,23,32H,8-13,17-19,22,24-25H2,1-7H3/b27-15+,28-16+,29-20+,30-21+,31-23+ |
| InChIKey | HKWKUDAFIYUXJR-UGMXIYSVSA-N |
| XLogP | 11.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|