C12H14O — CID 145446291
2,3a,4,5,5a,6-hexahydro-1H-as-indacen-3-one (PubChem CID 145446291) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 2,3a,4,5,5a,6-hexahydro-1H-as-indacen-3-one.
| Compound Name | 2,3a,4,5,5a,6-hexahydro-1H-as-indacen-3-one |
|---|---|
| PubChem CID | 145446291 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2,3a,4,5,5a,6-hexahydro-1H-as-indacen-3-one |
| SMILES | O=C1CCC2=C3C=CCC3CCC12 |
| InChI | InChI=1S/C12H14O/c13-12-7-6-10-9-3-1-2-8(9)4-5-11(10)12/h1,3,8,11H,2,4-7H2 |
| InChIKey | FSJRSPBKBTUEAB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |