C31H37FN4O3 — CID 145446652
4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[2-(3-fluorophenyl)-5-(2-methylbut-3-en-2-yl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide (PubChem CID 145446652) has the molecular formula C31H37FN4O3 and a molecular weight of 532.66 g/mol. Its IUPAC name is 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[2-(3-fluorophenyl)-5-(2-methylbut-3-en-2-yl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide.
| Compound Name | 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[2-(3-fluorophenyl)-5-(2-methylbut-3-en-2-yl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 145446652 |
| Molecular Formula | C31H37FN4O3 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[2-(3-fluorophenyl)-5-(2-methylbut-3-en-2-yl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide |
| SMILES | [H]/N=C(C)/C=C(/Cc1ccc(C(=O)NCC(=O)N2C(c3cccc(F)c3)CCC2C(C)(C)C=C)cc1C)C(N)=O |
| InChI | InChI=1S/C31H37FN4O3/c1-6-31(4,5)27-13-12-26(22-8-7-9-25(32)17-22)36(27)28(37)18-35-30(39)23-11-10-21(19(2)14-23)16-24(29(34)38)15-20(3)33/h6-11,14-15,17,26-27,33H,1,12-13,16,18H2,2-5H3,(H2,34,38)(H,35,39)/b24-15-,33-20+ |
| InChIKey | OVKAMPPCZQEYGT-NHDPELRESA-N |
| XLogP | 4.80 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|