C30H33ClFN5O4 — CID 145446734
4-[(E)-1-amino-4-imino-1-oxopent-2-en-2-yl]oxy-N-[(2R)-1-[2-(3-chloro-5-fluorophenyl)-5-(2-cyanopropan-2-yl)pyrrolidin-1-yl]-1-oxopropan-2-yl]-3-methylbenzamide (PubChem CID 145446734) has the molecular formula C30H33ClFN5O4 and a molecular weight of 582.08 g/mol. Its IUPAC name is 4-[(E)-1-amino-4-imino-1-oxopent-2-en-2-yl]oxy-N-[(2R)-1-[2-(3-chloro-5-fluorophenyl)-5-(2-cyanopropan-2-yl)pyrrolidin-1-yl]-1-oxopropan-2-yl]-3-methylbenzamide.
| Compound Name | 4-[(E)-1-amino-4-imino-1-oxopent-2-en-2-yl]oxy-N-[(2R)-1-[2-(3-chloro-5-fluorophenyl)-5-(2-cyanopropan-2-yl)pyrrolidin-1-yl]-1-oxopropan-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 145446734 |
| Molecular Formula | C30H33ClFN5O4 |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 4-[(E)-1-amino-4-imino-1-oxopent-2-en-2-yl]oxy-N-[(2R)-1-[2-(3-chloro-5-fluorophenyl)-5-(2-cyanopropan-2-yl)pyrrolidin-1-yl]-1-oxopropan-2-yl]-3-methylbenzamide |
| SMILES | [H]/N=C(C)/C=C(/Oc1ccc(C(=O)N[C@H](C)C(=O)N2C(c3cc(F)cc(Cl)c3)CCC2C(C)(C)C#N)cc1C)C(N)=O |
| InChI | InChI=1S/C30H33ClFN5O4/c1-16-10-19(6-8-24(16)41-25(27(35)38)11-17(2)34)28(39)36-18(3)29(40)37-23(7-9-26(37)30(4,5)15-33)20-12-21(31)14-22(32)13-20/h6,8,10-14,18,23,26,34H,7,9H2,1-5H3,(H2,35,38)(H,36,39)/b25-11+,34-17+/t18-,23?,26?/m1/s1 |
| InChIKey | VYJOMAJIHFFHLJ-WIAXGAGBSA-N |
| XLogP | 4.98 |
| TPSA | 149.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|