C17H24ClN3O — CID 145446747
(2R)-2-amino-1-[2-(3-chlorophenyl)pyrrolidin-1-yl]propan-1-one;2-methylpropanenitrile (PubChem CID 145446747) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is (2R)-2-amino-1-[2-(3-chlorophenyl)pyrrolidin-1-yl]propan-1-one;2-methylpropanenitrile.
| Compound Name | (2R)-2-amino-1-[2-(3-chlorophenyl)pyrrolidin-1-yl]propan-1-one;2-methylpropanenitrile |
|---|---|
| PubChem CID | 145446747 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (2R)-2-amino-1-[2-(3-chlorophenyl)pyrrolidin-1-yl]propan-1-one;2-methylpropanenitrile |
| SMILES | CC(C)C#N.C[C@@H](N)C(=O)N1CCCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O.C4H7N/c1-9(15)13(17)16-7-3-6-12(16)10-4-2-5-11(14)8-10;1-4(2)3-5/h2,4-5,8-9,12H,3,6-7,15H2,1H3;4H,1-2H3/t9-,12?;/m1./s1 |
| InChIKey | FDNIQXYBIKUEGW-SWHRJYHISA-N |
| XLogP | 3.52 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |