About (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium
(Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium (PubChem CID 14544801) has the molecular formula C4HF3N3O+
and a molecular weight of 164.07 g/mol. Its IUPAC name is (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium.
Molecular Properties
| Compound Name | (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium |
| PubChem CID | 14544801 |
| Molecular Formula | C4HF3N3O+ |
| Molecular Weight | 164.07 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium |
| SMILES | N#C/C([N+]#N)=C(/O)C(F)(F)F |
| InChI | InChI=1S/C4F3N3O/c5-4(6,7)3(11)2(1-8)10-9/p+1/b3-2- |
| InChIKey | RHBPHCXIZRHKAD-IHWYPQMZSA-O |
| XLogP | 1.69 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.07 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium?
The IUPAC name of (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium (CID 14544801) is (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium.
What is the SMILES notation for (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium?
The canonical SMILES for (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium is N#C/C([N+]#N)=C(/O)C(F)(F)F.
What is the InChIKey of (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium?
The InChIKey is RHBPHCXIZRHKAD-IHWYPQMZSA-O. The full InChI is InChI=1S/C4F3N3O/c5-4(6,7)3(11)2(1-8)10-9/p+1/b3-2-.
What are the key properties of (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium?
(Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium has a molecular weight of 164.07 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-cyano-3,3,3-trifluoro-2-hydroxyprop-1-ene-1-diazonium is sourced from PubChem (CID 14544801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).