C12H19NO5 — CID 145448652
methyl acetate;1-(2-oxopyrrolidin-1-yl)ethyl prop-2-enoate (PubChem CID 145448652) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl acetate;1-(2-oxopyrrolidin-1-yl)ethyl prop-2-enoate.
| Compound Name | methyl acetate;1-(2-oxopyrrolidin-1-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 145448652 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | methyl acetate;1-(2-oxopyrrolidin-1-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)N1CCCC1=O.COC(C)=O |
| InChI | InChI=1S/C9H13NO3.C3H6O2/c1-3-9(12)13-7(2)10-6-4-5-8(10)11;1-3(4)5-2/h3,7H,1,4-6H2,2H3;1-2H3 |
| InChIKey | KOSFVZWQXUFTFL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|