About ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide
ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide (PubChem CID 145449190) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide.
Molecular Properties
| Compound Name | ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide |
| PubChem CID | 145449190 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide |
| SMILES | CC.CC1=CC2N=C(C(N)=O)C=NC2C=C1 |
| InChI | InChI=1S/C10H11N3O.C2H6/c1-6-2-3-7-8(4-6)13-9(5-12-7)10(11)14;1-2/h2-5,7-8H,1H3,(H2,11,14);1-2H3 |
| InChIKey | DXTZWYDWCRMPII-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide?
The IUPAC name of ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide (CID 145449190) is ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide.
What is the SMILES notation for ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide?
The canonical SMILES for ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide is CC.CC1=CC2N=C(C(N)=O)C=NC2C=C1.
What is the InChIKey of ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide?
The InChIKey is DXTZWYDWCRMPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O.C2H6/c1-6-2-3-7-8(4-6)13-9(5-12-7)10(11)14;1-2/h2-5,7-8H,1H3,(H2,11,14);1-2H3.
What are the key properties of ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide?
ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide has a molecular weight of 219.29 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-4a,8a-dihydroquinoxaline-2-carboxamide is sourced from PubChem (CID 145449190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).