About (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol
(1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol (PubChem CID 145449485) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol.
Molecular Properties
| Compound Name | (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol |
| PubChem CID | 145449485 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol |
| SMILES | C=CC(=C)N(C)C(=C)/C=C/O |
| InChI | InChI=1S/C9H13NO/c1-5-8(2)10(4)9(3)6-7-11/h5-7,11H,1-3H2,4H3/b7-6+ |
| InChIKey | INANUMMVUWCHIX-VOTSOKGWSA-N |
| XLogP | 2.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol?
The IUPAC name of (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol (CID 145449485) is (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol.
What is the SMILES notation for (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol?
The canonical SMILES for (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol is C=CC(=C)N(C)C(=C)/C=C/O.
What is the InChIKey of (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol?
The InChIKey is INANUMMVUWCHIX-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H13NO/c1-5-8(2)10(4)9(3)6-7-11/h5-7,11H,1-3H2,4H3/b7-6+.
What are the key properties of (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol?
(1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol has a molecular weight of 151.21 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-3-[buta-1,3-dien-2-yl(methyl)amino]buta-1,3-dien-1-ol is sourced from PubChem (CID 145449485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).