About [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate
[5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate (PubChem CID 14544997) has the molecular formula C12H12O6
and a molecular weight of 252.22 g/mol. Its IUPAC name is [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate.
Molecular Properties
| Compound Name | [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate |
| PubChem CID | 14544997 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC(=O)C=C(COC(C)=O)C1=O |
| InChI | InChI=1S/C12H12O6/c1-7(13)17-5-9-3-11(15)4-10(12(9)16)6-18-8(2)14/h3-4H,5-6H2,1-2H3 |
| InChIKey | VAZHHZVEHFDBNK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate?
The IUPAC name of [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate (CID 14544997) is [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate.
What is the SMILES notation for [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate?
The canonical SMILES for [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate is CC(=O)OCC1=CC(=O)C=C(COC(C)=O)C1=O.
What is the InChIKey of [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate?
The InChIKey is VAZHHZVEHFDBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O6/c1-7(13)17-5-9-3-11(15)4-10(12(9)16)6-18-8(2)14/h3-4H,5-6H2,1-2H3.
What are the key properties of [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate?
[5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate has a molecular weight of 252.22 g/mol, XLogP of 0.12, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(acetyloxymethyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl acetate is sourced from PubChem (CID 14544997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).