About 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid
4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid (PubChem CID 14544999) has the molecular formula C11H10O6
and a molecular weight of 238.19 g/mol. Its IUPAC name is 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid |
| PubChem CID | 14544999 |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid |
| SMILES | O=C1C=CC(=O)C(COC(=O)CCC(=O)O)=C1 |
| InChI | InChI=1S/C11H10O6/c12-8-1-2-9(13)7(5-8)6-17-11(16)4-3-10(14)15/h1-2,5H,3-4,6H2,(H,14,15) |
| InChIKey | GOUMUKGTUNRLEH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid?
The IUPAC name of 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid (CID 14544999) is 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid.
What is the SMILES notation for 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid?
The canonical SMILES for 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid is O=C1C=CC(=O)C(COC(=O)CCC(=O)O)=C1.
What is the InChIKey of 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid?
The InChIKey is GOUMUKGTUNRLEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O6/c12-8-1-2-9(13)7(5-8)6-17-11(16)4-3-10(14)15/h1-2,5H,3-4,6H2,(H,14,15).
What are the key properties of 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid?
4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid has a molecular weight of 238.19 g/mol, XLogP of 0.03, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methoxy]-4-oxobutanoic acid is sourced from PubChem (CID 14544999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).