About 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane
3-tert-butyl-1,2,3-trimethylcyclohexene;ethane (PubChem CID 145450127) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane.
Molecular Properties
| Compound Name | 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane |
| PubChem CID | 145450127 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane |
| SMILES | CC.CC1=C(C)C(C)(C(C)(C)C)CCC1 |
| InChI | InChI=1S/C13H24.C2H6/c1-10-8-7-9-13(6,11(10)2)12(3,4)5;1-2/h7-9H2,1-6H3;1-2H3 |
| InChIKey | KFAHHCDERGHULN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane?
The IUPAC name of 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane (CID 145450127) is 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane.
What is the SMILES notation for 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane?
The canonical SMILES for 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane is CC.CC1=C(C)C(C)(C(C)(C)C)CCC1.
What is the InChIKey of 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane?
The InChIKey is KFAHHCDERGHULN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24.C2H6/c1-10-8-7-9-13(6,11(10)2)12(3,4)5;1-2/h7-9H2,1-6H3;1-2H3.
What are the key properties of 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane?
3-tert-butyl-1,2,3-trimethylcyclohexene;ethane has a molecular weight of 210.40 g/mol, XLogP of 5.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1,2,3-trimethylcyclohexene;ethane is sourced from PubChem (CID 145450127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).