C21H21F6N9OS — CID 145450831
7-[1-(dimethylamino)-2,2,2-trifluoroethyl]-N,2-dimethyl-[1,3]thiazolo[5,4-b]pyridin-6-amine;N-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]formamide (PubChem CID 145450831) has the molecular formula C21H21F6N9OS and a molecular weight of 561.52 g/mol. Its IUPAC name is 7-[1-(dimethylamino)-2,2,2-trifluoroethyl]-N,2-dimethyl-[1,3]thiazolo[5,4-b]pyridin-6-amine;N-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]formamide.
| Compound Name | 7-[1-(dimethylamino)-2,2,2-trifluoroethyl]-N,2-dimethyl-[1,3]thiazolo[5,4-b]pyridin-6-amine;N-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 145450831 |
| Molecular Formula | C21H21F6N9OS |
| Molecular Weight | 561.52 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 7-[1-(dimethylamino)-2,2,2-trifluoroethyl]-N,2-dimethyl-[1,3]thiazolo[5,4-b]pyridin-6-amine;N-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]formamide |
| SMILES | CNc1cnc2sc(C)nc2c1C(N(C)C)C(F)(F)F.O=CNc1cnc(-n2nccn2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N4S.C9H6F3N5O/c1-6-18-9-8(10(19(3)4)12(13,14)15)7(16-2)5-17-11(9)20-6;10-9(11,12)7-3-6(14-5-18)4-13-8(7)17-15-1-2-16-17/h5,10,16H,1-4H3;1-5H,(H,14,18) |
| InChIKey | XWUATPSPXBXPQQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|