About ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol
ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol (PubChem CID 145450980) has the molecular formula C15H18OS
and a molecular weight of 246.38 g/mol. Its IUPAC name is ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol.
Molecular Properties
| Compound Name | ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol |
| PubChem CID | 145450980 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol |
| SMILES | CC.OC1=CC(Sc2ccccc2)=CC=CC1 |
| InChI | InChI=1S/C13H12OS.C2H6/c14-11-6-4-5-9-13(10-11)15-12-7-2-1-3-8-12;1-2/h1-5,7-10,14H,6H2;1-2H3 |
| InChIKey | PQLMUXOJZOVNJG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol?
The IUPAC name of ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol (CID 145450980) is ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol.
What is the SMILES notation for ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol?
The canonical SMILES for ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol is CC.OC1=CC(Sc2ccccc2)=CC=CC1.
What is the InChIKey of ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol?
The InChIKey is PQLMUXOJZOVNJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12OS.C2H6/c14-11-6-4-5-9-13(10-11)15-12-7-2-1-3-8-12;1-2/h1-5,7-10,14H,6H2;1-2H3.
What are the key properties of ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol?
ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol has a molecular weight of 246.38 g/mol, XLogP of 5.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-phenylsulfanylcyclohepta-1,3,5-trien-1-ol is sourced from PubChem (CID 145450980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).