C18H30O2 — CID 145451074
3-(7-cyclohexa-2,4-dien-1-yloxyheptyl)-3-ethyloxetane (PubChem CID 145451074) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 3-(7-cyclohexa-2,4-dien-1-yloxyheptyl)-3-ethyloxetane.
| Compound Name | 3-(7-cyclohexa-2,4-dien-1-yloxyheptyl)-3-ethyloxetane |
|---|---|
| PubChem CID | 145451074 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 3-(7-cyclohexa-2,4-dien-1-yloxyheptyl)-3-ethyloxetane |
| SMILES | CCC1(CCCCCCCOC2C=CC=CC2)COC1 |
| InChI | InChI=1S/C18H30O2/c1-2-18(15-19-16-18)13-9-4-3-5-10-14-20-17-11-7-6-8-12-17/h6-8,11,17H,2-5,9-10,12-16H2,1H3 |
| InChIKey | TVHMIZLQQYZPMB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|