C25H32O4 — CID 145451130
[4-[(3Z)-5-[(2-methylpropan-2-yl)oxy]hexa-1,3,5-trien-2-yl]cyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 145451130) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is [4-[(3Z)-5-[(2-methylpropan-2-yl)oxy]hexa-1,3,5-trien-2-yl]cyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [4-[(3Z)-5-[(2-methylpropan-2-yl)oxy]hexa-1,3,5-trien-2-yl]cyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 145451130 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | [4-[(3Z)-5-[(2-methylpropan-2-yl)oxy]hexa-1,3,5-trien-2-yl]cyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C=C(/C=C\C(=C)C1CCC(OC(=O)/C=C/c2ccc(O)cc2)CC1)OC(C)(C)C |
| InChI | InChI=1S/C25H32O4/c1-18(6-7-19(2)29-25(3,4)5)21-11-15-23(16-12-21)28-24(27)17-10-20-8-13-22(26)14-9-20/h6-10,13-14,17,21,23,26H,1-2,11-12,15-16H2,3-5H3/b7-6-,17-10+ |
| InChIKey | WTRLQYWMPMSELZ-GCMZLDECSA-N |
| XLogP | 5.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|