C17H29F3N2 — CID 145451253
(3aS)-5-(2-cyclohexylethyl)-2-(2,2,2-trifluoroethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 145451253) has the molecular formula C17H29F3N2 and a molecular weight of 318.43 g/mol. Its IUPAC name is (3aS)-5-(2-cyclohexylethyl)-2-(2,2,2-trifluoroethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine.
| Compound Name | (3aS)-5-(2-cyclohexylethyl)-2-(2,2,2-trifluoroethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 145451253 |
| Molecular Formula | C17H29F3N2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (3aS)-5-(2-cyclohexylethyl)-2-(2,2,2-trifluoroethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | FC(F)(F)CN1CC2CCN(CCC3CCCCC3)C[C@H]2C1 |
| InChI | InChI=1S/C17H29F3N2/c18-17(19,20)13-22-10-15-7-9-21(11-16(15)12-22)8-6-14-4-2-1-3-5-14/h14-16H,1-13H2/t15?,16-/m0/s1 |
| InChIKey | GWXRXMGVKVVECJ-LYKKTTPLSA-N |
| XLogP | 3.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |