C27H32F2N4O2S — CID 145451333
N-[(1R,4R)-4-[2-[2-(2,2-difluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]-3-methylcyclohexyl]quinoline-5-carboxamide (PubChem CID 145451333) has the molecular formula C27H32F2N4O2S and a molecular weight of 514.64 g/mol. Its IUPAC name is N-[(1R,4R)-4-[2-[2-(2,2-difluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]-3-methylcyclohexyl]quinoline-5-carboxamide.
| Compound Name | N-[(1R,4R)-4-[2-[2-(2,2-difluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]-3-methylcyclohexyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 145451333 |
| Molecular Formula | C27H32F2N4O2S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | N-[(1R,4R)-4-[2-[2-(2,2-difluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]-3-methylcyclohexyl]quinoline-5-carboxamide |
| SMILES | CC1C[C@H](NC(=O)c2cccc3ncccc23)CC[C@@H]1CCN1CCc2sc(OCC(F)F)nc2C1 |
| InChI | InChI=1S/C27H32F2N4O2S/c1-17-14-19(31-26(34)21-4-2-6-22-20(21)5-3-11-30-22)8-7-18(17)9-12-33-13-10-24-23(15-33)32-27(36-24)35-16-25(28)29/h2-6,11,17-19,25H,7-10,12-16H2,1H3,(H,31,34)/t17?,18-,19-/m1/s1 |
| InChIKey | ARZZSGMJUYPPEO-OMKBGSMGSA-N |
| XLogP | 5.32 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |