C30H41F3N6O — CID 145451350
7-(2-cyclohexylethyl)-2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;ethene;2-methylindazole-4-carboxamide (PubChem CID 145451350) has the molecular formula C30H41F3N6O and a molecular weight of 558.69 g/mol. Its IUPAC name is 7-(2-cyclohexylethyl)-2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;ethene;2-methylindazole-4-carboxamide.
| Compound Name | 7-(2-cyclohexylethyl)-2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;ethene;2-methylindazole-4-carboxamide |
|---|---|
| PubChem CID | 145451350 |
| Molecular Formula | C30H41F3N6O |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | 7-(2-cyclohexylethyl)-2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;ethene;2-methylindazole-4-carboxamide |
| SMILES | C=C.Cn1cc2c(C(N)=O)cccc2n1.FC(F)(F)CCc1ncc2c(n1)CCN(CCC1CCCCC1)CC2 |
| InChI | InChI=1S/C19H28F3N3.C9H9N3O.C2H4/c20-19(21,22)10-6-18-23-14-16-8-12-25(13-9-17(16)24-18)11-7-15-4-2-1-3-5-15;1-12-5-7-6(9(10)13)3-2-4-8(7)11-12;1-2/h14-15H,1-13H2;2-5H,1H3,(H2,10,13);1-2H2 |
| InChIKey | BSFDEVJHMALIHI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|