C19H29F3N2O — CID 145451478
7-(3-ethylhexyl)-2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine (PubChem CID 145451478) has the molecular formula C19H29F3N2O and a molecular weight of 358.45 g/mol. Its IUPAC name is 7-(3-ethylhexyl)-2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine.
| Compound Name | 7-(3-ethylhexyl)-2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine |
|---|---|
| PubChem CID | 145451478 |
| Molecular Formula | C19H29F3N2O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 7-(3-ethylhexyl)-2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine |
| SMILES | CCCC(CC)CCN1CCc2ccc(OCC(F)(F)F)nc2CC1 |
| InChI | InChI=1S/C19H29F3N2O/c1-3-5-15(4-2)8-11-24-12-9-16-6-7-18(23-17(16)10-13-24)25-14-19(20,21)22/h6-7,15H,3-5,8-14H2,1-2H3 |
| InChIKey | IHMJGZWJVVJDNR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |