C31H44F2N4O3 — CID 145451576
7-(2-cyclohexylethyl)-2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine;methanamine;2-methyl-1-oxo-3H-isoindole-4-carbaldehyde (PubChem CID 145451576) has the molecular formula C31H44F2N4O3 and a molecular weight of 558.71 g/mol. Its IUPAC name is 7-(2-cyclohexylethyl)-2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine;methanamine;2-methyl-1-oxo-3H-isoindole-4-carbaldehyde.
| Compound Name | 7-(2-cyclohexylethyl)-2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine;methanamine;2-methyl-1-oxo-3H-isoindole-4-carbaldehyde |
|---|---|
| PubChem CID | 145451576 |
| Molecular Formula | C31H44F2N4O3 |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | 7-(2-cyclohexylethyl)-2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepine;methanamine;2-methyl-1-oxo-3H-isoindole-4-carbaldehyde |
| SMILES | CC(F)(F)COc1ccc2c(n1)CCN(CCC1CCCCC1)CC2.CN.CN1Cc2c(C=O)cccc2C1=O |
| InChI | InChI=1S/C20H30F2N2O.C10H9NO2.CH5N/c1-20(21,22)15-25-19-8-7-17-10-13-24(14-11-18(17)23-19)12-9-16-5-3-2-4-6-16;1-11-5-9-7(6-12)3-2-4-8(9)10(11)13;1-2/h7-8,16H,2-6,9-15H2,1H3;2-4,6H,5H2,1H3;2H2,1H3 |
| InChIKey | BLAHFKGZTQOTSU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|