C15H22F3N3O2 — CID 145451662
tert-butyl 2-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[1,5-d][1,4]diazepine-6-carboxylate (PubChem CID 145451662) has the molecular formula C15H22F3N3O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is tert-butyl 2-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[1,5-d][1,4]diazepine-6-carboxylate.
| Compound Name | tert-butyl 2-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[1,5-d][1,4]diazepine-6-carboxylate |
|---|---|
| PubChem CID | 145451662 |
| Molecular Formula | C15H22F3N3O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | tert-butyl 2-(3,3,3-trifluoropropyl)-4,5,7,8-tetrahydropyrazolo[1,5-d][1,4]diazepine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(CCC(F)(F)F)nn2CC1 |
| InChI | InChI=1S/C15H22F3N3O2/c1-14(2,3)23-13(22)20-7-5-12-10-11(4-6-15(16,17)18)19-21(12)9-8-20/h10H,4-9H2,1-3H3 |
| InChIKey | SCJLSJTVGKJBQD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |