C18H28F2N2O2S — CID 145451865
6-(2-cyclohexylethyl)-2-(2,2-difluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-4-ol (PubChem CID 145451865) has the molecular formula C18H28F2N2O2S and a molecular weight of 374.50 g/mol. Its IUPAC name is 6-(2-cyclohexylethyl)-2-(2,2-difluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-4-ol.
| Compound Name | 6-(2-cyclohexylethyl)-2-(2,2-difluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-4-ol |
|---|---|
| PubChem CID | 145451865 |
| Molecular Formula | C18H28F2N2O2S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 6-(2-cyclohexylethyl)-2-(2,2-difluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-4-ol |
| SMILES | CC(F)(F)COc1nc2c(s1)CCN(CCC1CCCCC1)CC2O |
| InChI | InChI=1S/C18H28F2N2O2S/c1-18(19,20)12-24-17-21-16-14(23)11-22(10-8-15(16)25-17)9-7-13-5-3-2-4-6-13/h13-14,23H,2-12H2,1H3 |
| InChIKey | UOXZNPLKLMWMOJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |