About 5-ethyl-2-methyl-6H-1,3,4-thiadiazine
5-ethyl-2-methyl-6H-1,3,4-thiadiazine (PubChem CID 145451894) has the molecular formula C6H10N2S
and a molecular weight of 142.23 g/mol. Its IUPAC name is 5-ethyl-2-methyl-6H-1,3,4-thiadiazine.
Molecular Properties
| Compound Name | 5-ethyl-2-methyl-6H-1,3,4-thiadiazine |
| PubChem CID | 145451894 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 5-ethyl-2-methyl-6H-1,3,4-thiadiazine |
| SMILES | CCC1=NN=C(C)SC1 |
| InChI | InChI=1S/C6H10N2S/c1-3-6-4-9-5(2)7-8-6/h3-4H2,1-2H3 |
| InChIKey | OFOFHEFZKCWWGD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-2-methyl-6H-1,3,4-thiadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methyl-6H-1,3,4-thiadiazine?
The IUPAC name of 5-ethyl-2-methyl-6H-1,3,4-thiadiazine (CID 145451894) is 5-ethyl-2-methyl-6H-1,3,4-thiadiazine.
What is the SMILES notation for 5-ethyl-2-methyl-6H-1,3,4-thiadiazine?
The canonical SMILES for 5-ethyl-2-methyl-6H-1,3,4-thiadiazine is CCC1=NN=C(C)SC1.
What is the InChIKey of 5-ethyl-2-methyl-6H-1,3,4-thiadiazine?
The InChIKey is OFOFHEFZKCWWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S/c1-3-6-4-9-5(2)7-8-6/h3-4H2,1-2H3.
What are the key properties of 5-ethyl-2-methyl-6H-1,3,4-thiadiazine?
5-ethyl-2-methyl-6H-1,3,4-thiadiazine has a molecular weight of 142.23 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methyl-6H-1,3,4-thiadiazine is sourced from PubChem (CID 145451894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).