C22H32N2 — CID 145452318
1-[4-[(E)-but-2-enyl]cyclohex-3-en-1-yl]cyclohexa-1,3-diene;cyclohexa-1,5-dien-1-ylhydrazine (PubChem CID 145452318) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-[4-[(E)-but-2-enyl]cyclohex-3-en-1-yl]cyclohexa-1,3-diene;cyclohexa-1,5-dien-1-ylhydrazine.
| Compound Name | 1-[4-[(E)-but-2-enyl]cyclohex-3-en-1-yl]cyclohexa-1,3-diene;cyclohexa-1,5-dien-1-ylhydrazine |
|---|---|
| PubChem CID | 145452318 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 1-[4-[(E)-but-2-enyl]cyclohex-3-en-1-yl]cyclohexa-1,3-diene;cyclohexa-1,5-dien-1-ylhydrazine |
| SMILES | C/C=C/CC1=CCC(C2=CC=CCC2)CC1.NNC1=CCCC=C1 |
| InChI | InChI=1S/C16H22.C6H10N2/c1-2-3-7-14-10-12-16(13-11-14)15-8-5-4-6-9-15;7-8-6-4-2-1-3-5-6/h2-5,8,10,16H,6-7,9,11-13H2,1H3;2,4-5,8H,1,3,7H2/b3-2+; |
| InChIKey | CLGMMAHTENSAMN-SQQVDAMQSA-N |
| XLogP | 5.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|