C70H57N3 — CID 145452364
(7Z,8E)-N-[4-[4-(1,2-dihydrocarbazol-9-yl)phenyl]phenyl]-7,8-di(ethylidene)-N-(7,9,9-triphenylfluoren-2-yl)quinolin-3-amine;ethane (PubChem CID 145452364) has the molecular formula C70H57N3 and a molecular weight of 940.25 g/mol. Its IUPAC name is (7Z,8E)-N-[4-[4-(1,2-dihydrocarbazol-9-yl)phenyl]phenyl]-7,8-di(ethylidene)-N-(7,9,9-triphenylfluoren-2-yl)quinolin-3-amine;ethane.
| Compound Name | (7Z,8E)-N-[4-[4-(1,2-dihydrocarbazol-9-yl)phenyl]phenyl]-7,8-di(ethylidene)-N-(7,9,9-triphenylfluoren-2-yl)quinolin-3-amine;ethane |
|---|---|
| PubChem CID | 145452364 |
| Molecular Formula | C70H57N3 |
| Molecular Weight | 940.25 g/mol |
| Exact Mass | 939.46 |
| IUPAC Name | (7Z,8E)-N-[4-[4-(1,2-dihydrocarbazol-9-yl)phenyl]phenyl]-7,8-di(ethylidene)-N-(7,9,9-triphenylfluoren-2-yl)quinolin-3-amine;ethane |
| SMILES | C/C=c1/ccc2cc(N(c3ccc(-c4ccc(-n5c6c(c7ccccc75)C=CCC6)cc4)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3cc(-c5ccccc5)ccc3-4)cnc2/c1=C/C.CC |
| InChI | InChI=1S/C68H51N3.C2H6/c1-3-46-28-29-51-42-57(45-69-67(51)58(46)4-2)70(54-35-30-48(31-36-54)49-32-37-55(38-33-49)71-65-26-16-14-24-61(65)62-25-15-17-27-66(62)71)56-39-41-60-59-40-34-50(47-18-8-5-9-19-47)43-63(59)68(64(60)44-56,52-20-10-6-11-21-52)53-22-12-7-13-23-53;1-2/h3-16,18-26,28-45H,17,27H2,1-2H3;1-2H3/b46-3-,58-4+; |
| InChIKey | LMZMPUAQGYNLPR-GQVVOXOGSA-N |
| XLogP | 16.93 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.25 |
| LogP ≤ 5 | 16.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |