About ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate
ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate (PubChem CID 145452988) has the molecular formula C22H25FN6O2
and a molecular weight of 424.48 g/mol. Its IUPAC name is ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate |
| PubChem CID | 145452988 |
| Molecular Formula | C22H25FN6O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(C)c2cc(F)cc(-c3ccc4ncnc(N)c4n3)c2)CC1 |
| InChI | InChI=1S/C22H25FN6O2/c1-3-31-22(30)29-8-6-16(7-9-29)28(2)17-11-14(10-15(23)12-17)18-4-5-19-20(27-18)21(24)26-13-25-19/h4-5,10-13,16H,3,6-9H2,1-2H3,(H2,24,25,26) |
| InChIKey | SPOJFZOMTPNGGL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate (CID 145452988) is ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate is CCOC(=O)N1CCC(N(C)c2cc(F)cc(-c3ccc4ncnc(N)c4n3)c2)CC1.
What is the InChIKey of ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate?
The InChIKey is SPOJFZOMTPNGGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FN6O2/c1-3-31-22(30)29-8-6-16(7-9-29)28(2)17-11-14(10-15(23)12-17)18-4-5-19-20(27-18)21(24)26-13-25-19/h4-5,10-13,16H,3,6-9H2,1-2H3,(H2,24,25,26).
What are the key properties of ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate?
ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate has a molecular weight of 424.48 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-methylanilino]piperidine-1-carboxylate is sourced from PubChem (CID 145452988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).