C26H22F3NO2 — CID 145453079
benzyl (2R,3R)-4-methylidene-2-(3-methylphenyl)-3-(2,4,6-trifluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 145453079) has the molecular formula C26H22F3NO2 and a molecular weight of 437.46 g/mol. Its IUPAC name is benzyl (2R,3R)-4-methylidene-2-(3-methylphenyl)-3-(2,4,6-trifluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3R)-4-methylidene-2-(3-methylphenyl)-3-(2,4,6-trifluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145453079 |
| Molecular Formula | C26H22F3NO2 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | benzyl (2R,3R)-4-methylidene-2-(3-methylphenyl)-3-(2,4,6-trifluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | C=C1CN(C(=O)OCc2ccccc2)[C@@H](c2cccc(C)c2)[C@H]1c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C26H22F3NO2/c1-16-7-6-10-19(11-16)25-23(24-21(28)12-20(27)13-22(24)29)17(2)14-30(25)26(31)32-15-18-8-4-3-5-9-18/h3-13,23,25H,2,14-15H2,1H3/t23-,25+/m1/s1 |
| InChIKey | DXZFNOSLIMWUKP-NOZRDPDXSA-N |
| XLogP | 6.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|