About 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene
2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene (PubChem CID 145453086) has the molecular formula C11H10F3NO2S
and a molecular weight of 277.27 g/mol. Its IUPAC name is 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene.
Molecular Properties
| Compound Name | 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene |
| PubChem CID | 145453086 |
| Molecular Formula | C11H10F3NO2S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene |
| SMILES | C=C1C[C@H]([N+](=O)[O-])[C@@H](c2cccs2)[C@H]1C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO2S/c1-6-5-7(15(16)17)9(8-3-2-4-18-8)10(6)11(12,13)14/h2-4,7,9-10H,1,5H2/t7-,9-,10-/m0/s1 |
| InChIKey | GEBHQXCBNDOUTM-HGNGGELXSA-N |
| XLogP | 3.62 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene?
The IUPAC name of 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene (CID 145453086) is 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene.
What is the SMILES notation for 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene?
The canonical SMILES for 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene is C=C1C[C@H]([N+](=O)[O-])[C@@H](c2cccs2)[C@H]1C(F)(F)F.
What is the InChIKey of 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene?
The InChIKey is GEBHQXCBNDOUTM-HGNGGELXSA-N. The full InChI is InChI=1S/C11H10F3NO2S/c1-6-5-7(15(16)17)9(8-3-2-4-18-8)10(6)11(12,13)14/h2-4,7,9-10H,1,5H2/t7-,9-,10-/m0/s1.
What are the key properties of 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene?
2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene has a molecular weight of 277.27 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R,5S)-3-methylidene-5-nitro-2-(trifluoromethyl)cyclopentyl]thiophene is sourced from PubChem (CID 145453086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).