C25H17F6NO2 — CID 145453124
benzyl (2R,3R)-2-(4-fluorophenyl)-4-methylidene-3-(2,3,4,5,6-pentafluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 145453124) has the molecular formula C25H17F6NO2 and a molecular weight of 477.40 g/mol. Its IUPAC name is benzyl (2R,3R)-2-(4-fluorophenyl)-4-methylidene-3-(2,3,4,5,6-pentafluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3R)-2-(4-fluorophenyl)-4-methylidene-3-(2,3,4,5,6-pentafluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145453124 |
| Molecular Formula | C25H17F6NO2 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | benzyl (2R,3R)-2-(4-fluorophenyl)-4-methylidene-3-(2,3,4,5,6-pentafluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | C=C1CN(C(=O)OCc2ccccc2)[C@@H](c2ccc(F)cc2)[C@H]1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H17F6NO2/c1-13-11-32(25(33)34-12-14-5-3-2-4-6-14)24(15-7-9-16(26)10-8-15)17(13)18-19(27)21(29)23(31)22(30)20(18)28/h2-10,17,24H,1,11-12H2/t17-,24+/m1/s1 |
| InChIKey | LYUZXDGRDGQOTD-OSPHWJPCSA-N |
| XLogP | 6.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|