C21H26ClNO3 — CID 145453232
2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]-1-methyl-1-oxidopiperidin-1-ium;hydrochloride (PubChem CID 145453232) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is 2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]-1-methyl-1-oxidopiperidin-1-ium;hydrochloride.
| Compound Name | 2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]-1-methyl-1-oxidopiperidin-1-ium;hydrochloride |
|---|---|
| PubChem CID | 145453232 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]-1-methyl-1-oxidopiperidin-1-ium;hydrochloride |
| SMILES | C[N+]1([O-])CCCCC1[C@@H]1COC(c2ccccc2)(c2ccccc2)O1.Cl |
| InChI | InChI=1S/C21H25NO3.ClH/c1-22(23)15-9-8-14-19(22)20-16-24-21(25-20,17-10-4-2-5-11-17)18-12-6-3-7-13-18;/h2-7,10-13,19-20H,8-9,14-16H2,1H3;1H/t19?,20-,22?;/m0./s1 |
| InChIKey | VWQRIUNFSCMDPQ-LADVQKINSA-N |
| XLogP | 4.22 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|