About 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate
3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate (PubChem CID 145453281) has the molecular formula C17H31N5O2S
and a molecular weight of 369.54 g/mol. Its IUPAC name is 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate.
Molecular Properties
| Compound Name | 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate |
| PubChem CID | 145453281 |
| Molecular Formula | C17H31N5O2S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate |
| SMILES | CCCCCCn1c(=O)n(C)c(=S)c2[nH]cnc21.C[N+](C)(C)CC[O-] |
| InChI | InChI=1S/C12H18N4OS.C5H13NO/c1-3-4-5-6-7-16-10-9(13-8-14-10)11(18)15(2)12(16)17;1-6(2,3)4-5-7/h8H,3-7H2,1-2H3,(H,13,14);4-5H2,1-3H3 |
| InChIKey | CLHPJLZJPXRWRC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate?
The IUPAC name of 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate (CID 145453281) is 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate.
What is the SMILES notation for 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate?
The canonical SMILES for 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate is CCCCCCn1c(=O)n(C)c(=S)c2[nH]cnc21.C[N+](C)(C)CC[O-].
What is the InChIKey of 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate?
The InChIKey is CLHPJLZJPXRWRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4OS.C5H13NO/c1-3-4-5-6-7-16-10-9(13-8-14-10)11(18)15(2)12(16)17;1-6(2,3)4-5-7/h8H,3-7H2,1-2H3,(H,13,14);4-5H2,1-3H3.
What are the key properties of 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate?
3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate has a molecular weight of 369.54 g/mol, XLogP of 1.43, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexyl-1-methyl-6-sulfanylidene-7H-purin-2-one;2-(trimethylazaniumyl)ethanolate is sourced from PubChem (CID 145453281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).