C48H74N4O8S — CID 145453309
bis(dibutyl-[3-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyloxy)propyl]azanium);sulfate (PubChem CID 145453309) has the molecular formula C48H74N4O8S and a molecular weight of 867.21 g/mol. Its IUPAC name is bis(dibutyl-[3-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyloxy)propyl]azanium);sulfate.
| Compound Name | bis(dibutyl-[3-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyloxy)propyl]azanium);sulfate |
|---|---|
| PubChem CID | 145453309 |
| Molecular Formula | C48H74N4O8S |
| Molecular Weight | 867.21 g/mol |
| Exact Mass | 866.52 |
| IUPAC Name | bis(dibutyl-[3-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyloxy)propyl]azanium);sulfate |
| SMILES | CCCC[NH+](CCCC)CCCOC(=O)c1ccc2[nH]c3c(c2c1)CCCC3.CCCC[NH+](CCCC)CCCOC(=O)c1ccc2[nH]c3c(c2c1)CCCC3.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C24H36N2O2.H2O4S/c2*1-3-5-14-26(15-6-4-2)16-9-17-28-24(27)19-12-13-23-21(18-19)20-10-7-8-11-22(20)25-23;1-5(2,3)4/h2*12-13,18,25H,3-11,14-17H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | VFXZQIFRPUHTRU-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 173.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.21 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|