C41H46N2O8 — CID 145453318
(6aR)-7,9-dimethyl-4-pentyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid (PubChem CID 145453318) has the molecular formula C41H46N2O8 and a molecular weight of 694.83 g/mol. Its IUPAC name is (6aR)-7,9-dimethyl-4-pentyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid.
| Compound Name | (6aR)-7,9-dimethyl-4-pentyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid |
|---|---|
| PubChem CID | 145453318 |
| Molecular Formula | C41H46N2O8 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | (6aR)-7,9-dimethyl-4-pentyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid |
| SMILES | CCCCCn1cc2c3c(cccc31)C1=CC(C)CN(C)[C@@H]1C2.Cc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C21H28N2.C20H18O8/c1-4-5-6-10-23-14-16-12-20-18(11-15(2)13-22(20)3)17-8-7-9-19(23)21(16)17;1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14/h7-9,11,14-15,20H,4-6,10,12-13H2,1-3H3;3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t15?,20-;/m1./s1 |
| InChIKey | PPGFZTLDCYZRFT-SCCOOGRJSA-N |
| XLogP | 6.94 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|