C28H40 — CID 14545340
1,3,5,7-tetratert-butyl-s-indacene (PubChem CID 14545340) has the molecular formula C28H40 and a molecular weight of 376.63 g/mol. Its IUPAC name is 1,3,5,7-tetratert-butyl-s-indacene.
| Compound Name | 1,3,5,7-tetratert-butyl-s-indacene |
|---|---|
| PubChem CID | 14545340 |
| Molecular Formula | C28H40 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | 1,3,5,7-tetratert-butyl-s-indacene |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)=c2cc3c(cc21)=C(C(C)(C)C)C=C3C(C)(C)C |
| InChI | InChI=1S/C28H40/c1-25(2,3)21-15-22(26(4,5)6)18-14-20-19(13-17(18)21)23(27(7,8)9)16-24(20)28(10,11)12/h13-16H,1-12H3 |
| InChIKey | XSHFMLKAINYIBV-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |