C18H28N6O5S — CID 145453973
(2R)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 145453973) has the molecular formula C18H28N6O5S and a molecular weight of 440.53 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 145453973 |
| Molecular Formula | C18H28N6O5S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C18H28N6O5S/c19-12(2-1-7-22-18(20)21)15(26)23-13(8-10-3-5-11(25)6-4-10)16(27)24-14(9-30)17(28)29/h3-6,12-14,25,30H,1-2,7-9,19H2,(H,23,26)(H,24,27)(H,28,29)(H4,20,21,22)/t12-,13-,14-/m0/s1 |
| InChIKey | BFDDUDQCPJWQRQ-IHRRRGAJSA-N |
| XLogP | -1.70 |
| TPSA | 206.15 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|