C11H19N3O7S — CID 145454886
(2S)-2-[[(2S,3R)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]butanedioic acid (PubChem CID 145454886) has the molecular formula C11H19N3O7S and a molecular weight of 337.35 g/mol. Its IUPAC name is (2S)-2-[[(2S,3R)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S,3R)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 145454886 |
| Molecular Formula | C11H19N3O7S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (2S)-2-[[(2S,3R)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]butanedioic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CS)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19N3O7S/c1-4(15)8(14-9(18)5(12)3-22)10(19)13-6(11(20)21)2-7(16)17/h4-6,8,15,22H,2-3,12H2,1H3,(H,13,19)(H,14,18)(H,16,17)(H,20,21)/t4-,5+,6+,8+/m1/s1 |
| InChIKey | ZLFRUAFDAIFNHN-LKXGYXEUSA-N |
| XLogP | -2.85 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|