About 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole
2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole (PubChem CID 14545510) has the molecular formula C18H18F2NO3PS
and a molecular weight of 397.38 g/mol. Its IUPAC name is 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole |
| PubChem CID | 14545510 |
| Molecular Formula | C18H18F2NO3PS |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole |
| SMILES | CCOP(=O)(Cc1ccc(-c2nc3cc(F)ccc3s2)cc1F)OCC |
| InChI | InChI=1S/C18H18F2NO3PS/c1-3-23-25(22,24-4-2)11-13-6-5-12(9-15(13)20)18-21-16-10-14(19)7-8-17(16)26-18/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | HXZVBFAUNGQUNJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole?
The IUPAC name of 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole (CID 14545510) is 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole.
What is the SMILES notation for 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole?
The canonical SMILES for 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole is CCOP(=O)(Cc1ccc(-c2nc3cc(F)ccc3s2)cc1F)OCC.
What is the InChIKey of 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole?
The InChIKey is HXZVBFAUNGQUNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2NO3PS/c1-3-23-25(22,24-4-2)11-13-6-5-12(9-15(13)20)18-21-16-10-14(19)7-8-17(16)26-18/h5-10H,3-4,11H2,1-2H3.
What are the key properties of 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole?
2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole has a molecular weight of 397.38 g/mol, XLogP of 6.01, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(diethoxyphosphorylmethyl)-3-fluorophenyl]-5-fluoro-1,3-benzothiazole is sourced from PubChem (CID 14545510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).