About (6E)-2-methylnona-6,8-dien-3-ol
(6E)-2-methylnona-6,8-dien-3-ol (PubChem CID 14545535) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is (6E)-2-methylnona-6,8-dien-3-ol.
Molecular Properties
| Compound Name | (6E)-2-methylnona-6,8-dien-3-ol |
| PubChem CID | 14545535 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (6E)-2-methylnona-6,8-dien-3-ol |
| SMILES | C=C/C=C/CCC(O)C(C)C |
| InChI | InChI=1S/C10H18O/c1-4-5-6-7-8-10(11)9(2)3/h4-6,9-11H,1,7-8H2,2-3H3/b6-5+ |
| InChIKey | YZBBHILJFNCECB-AATRIKPKSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-2-methylnona-6,8-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-2-methylnona-6,8-dien-3-ol?
The IUPAC name of (6E)-2-methylnona-6,8-dien-3-ol (CID 14545535) is (6E)-2-methylnona-6,8-dien-3-ol.
What is the SMILES notation for (6E)-2-methylnona-6,8-dien-3-ol?
The canonical SMILES for (6E)-2-methylnona-6,8-dien-3-ol is C=C/C=C/CCC(O)C(C)C.
What is the InChIKey of (6E)-2-methylnona-6,8-dien-3-ol?
The InChIKey is YZBBHILJFNCECB-AATRIKPKSA-N. The full InChI is InChI=1S/C10H18O/c1-4-5-6-7-8-10(11)9(2)3/h4-6,9-11H,1,7-8H2,2-3H3/b6-5+.
What are the key properties of (6E)-2-methylnona-6,8-dien-3-ol?
(6E)-2-methylnona-6,8-dien-3-ol has a molecular weight of 154.25 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-2-methylnona-6,8-dien-3-ol is sourced from PubChem (CID 14545535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).