About (3R)-3-hydroxy-5,5-dimethylhexanoic acid
(3R)-3-hydroxy-5,5-dimethylhexanoic acid (PubChem CID 14545622) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is (3R)-3-hydroxy-5,5-dimethylhexanoic acid.
Molecular Properties
| Compound Name | (3R)-3-hydroxy-5,5-dimethylhexanoic acid |
| PubChem CID | 14545622 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (3R)-3-hydroxy-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C8H16O3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | PHACRADGRHURFF-LURJTMIESA-N |
| XLogP | 1.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-hydroxy-5,5-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-hydroxy-5,5-dimethylhexanoic acid?
The IUPAC name of (3R)-3-hydroxy-5,5-dimethylhexanoic acid (CID 14545622) is (3R)-3-hydroxy-5,5-dimethylhexanoic acid.
What is the SMILES notation for (3R)-3-hydroxy-5,5-dimethylhexanoic acid?
The canonical SMILES for (3R)-3-hydroxy-5,5-dimethylhexanoic acid is CC(C)(C)C[C@@H](O)CC(=O)O.
What is the InChIKey of (3R)-3-hydroxy-5,5-dimethylhexanoic acid?
The InChIKey is PHACRADGRHURFF-LURJTMIESA-N. The full InChI is InChI=1S/C8H16O3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3,(H,10,11)/t6-/m0/s1.
What are the key properties of (3R)-3-hydroxy-5,5-dimethylhexanoic acid?
(3R)-3-hydroxy-5,5-dimethylhexanoic acid has a molecular weight of 160.21 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-5,5-dimethylhexanoic acid is sourced from PubChem (CID 14545622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).