3-(2,2-dimethylcyclopropyl)propanoic acid

C8H14O2 — CID 14545624

IUPAC3-(2,2-dimethylcyclopropyl)propanoic acid
SMILESCC1(C)CC1CCC(=O)O
InChIInChI=1S/C8H14O2/c1-8(2)5-6(8)3-4-7(9)10/h6H,3-5H2,1-2H3,(H,9,10)
InChIKeyJPXNJPGDQKWXFP-UHFFFAOYSA-N
MW142.20 g/mol
LogP1.90
Rot. Bonds3

About 3-(2,2-dimethylcyclopropyl)propanoic acid

3-(2,2-dimethylcyclopropyl)propanoic acid (PubChem CID 14545624) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-(2,2-dimethylcyclopropyl)propanoic acid.

Molecular Properties

Compound Name3-(2,2-dimethylcyclopropyl)propanoic acid
PubChem CID14545624
Molecular FormulaC8H14O2
Molecular Weight142.20 g/mol
Exact Mass142.10
IUPAC Name3-(2,2-dimethylcyclopropyl)propanoic acid
SMILESCC1(C)CC1CCC(=O)O
InChIInChI=1S/C8H14O2/c1-8(2)5-6(8)3-4-7(9)10/h6H,3-5H2,1-2H3,(H,9,10)
InChIKeyJPXNJPGDQKWXFP-UHFFFAOYSA-N
XLogP1.90
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.20
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-(2,2-dimethylcyclopropyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,2-dimethylcyclopropyl)propanoic acid?
The IUPAC name of 3-(2,2-dimethylcyclopropyl)propanoic acid (CID 14545624) is 3-(2,2-dimethylcyclopropyl)propanoic acid.
What is the SMILES notation for 3-(2,2-dimethylcyclopropyl)propanoic acid?
The canonical SMILES for 3-(2,2-dimethylcyclopropyl)propanoic acid is CC1(C)CC1CCC(=O)O.
What is the InChIKey of 3-(2,2-dimethylcyclopropyl)propanoic acid?
The InChIKey is JPXNJPGDQKWXFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-8(2)5-6(8)3-4-7(9)10/h6H,3-5H2,1-2H3,(H,9,10).
What are the key properties of 3-(2,2-dimethylcyclopropyl)propanoic acid?
3-(2,2-dimethylcyclopropyl)propanoic acid has a molecular weight of 142.20 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylcyclopropyl)propanoic acid is sourced from PubChem (CID 14545624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).