C19H29N5O6 — CID 145458578
(2S)-6-amino-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid (PubChem CID 145458578) has the molecular formula C19H29N5O6 and a molecular weight of 423.47 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145458578 |
| Molecular Formula | C19H29N5O6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C19H29N5O6/c20-8-2-1-3-14(19(29)30)23-18(28)15(10-16(22)26)24-17(27)13(21)9-11-4-6-12(25)7-5-11/h4-7,13-15,25H,1-3,8-10,20-21H2,(H2,22,26)(H,23,28)(H,24,27)(H,29,30)/t13-,14-,15-/m0/s1 |
| InChIKey | AYPAIRCDLARHLM-KKUMJFAQSA-N |
| XLogP | -1.68 |
| TPSA | 210.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|