About (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide
(Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide (PubChem CID 145459186) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide.
Molecular Properties
| Compound Name | (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide |
| PubChem CID | 145459186 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide |
| SMILES | [H]/N=C(/C=C\C(N)=O)C1=CCCC=C1 |
| InChI | InChI=1S/C10H12N2O/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h2,4-7,11H,1,3H2,(H2,12,13)/b7-6-,11-9- |
| InChIKey | FDUQUDJSUUIBJF-XEZITKEBSA-N |
| XLogP | 1.32 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide?
The IUPAC name of (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide (CID 145459186) is (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide.
What is the SMILES notation for (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide?
The canonical SMILES for (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide is [H]/N=C(/C=C\C(N)=O)C1=CCCC=C1.
What is the InChIKey of (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide?
The InChIKey is FDUQUDJSUUIBJF-XEZITKEBSA-N. The full InChI is InChI=1S/C10H12N2O/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h2,4-7,11H,1,3H2,(H2,12,13)/b7-6-,11-9-.
What are the key properties of (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide?
(Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide has a molecular weight of 176.22 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide is sourced from PubChem (CID 145459186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).